C9H12ClN5O2 — CID 14410788
2-[(6-aminopurin-9-yl)methoxy]-3-chloropropan-1-ol (PubChem CID 14410788) has the molecular formula C9H12ClN5O2 and a molecular weight of 257.68 g/mol. Its IUPAC name is 2-[(6-aminopurin-9-yl)methoxy]-3-chloropropan-1-ol.
| Compound Name | 2-[(6-aminopurin-9-yl)methoxy]-3-chloropropan-1-ol |
|---|---|
| PubChem CID | 14410788 |
| Molecular Formula | C9H12ClN5O2 |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 2-[(6-aminopurin-9-yl)methoxy]-3-chloropropan-1-ol |
| SMILES | Nc1ncnc2c1ncn2COC(CO)CCl |
| InChI | InChI=1S/C9H12ClN5O2/c10-1-6(2-16)17-5-15-4-14-7-8(11)12-3-13-9(7)15/h3-4,6,16H,1-2,5H2,(H2,11,12,13) |
| InChIKey | QWMUDWMIDTZAOV-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|