C12H21N6O3+ — CID 11013029
[2-amino-9-(1,3-dihydroxypropan-2-yloxymethyl)purin-6-yl]-trimethylazanium (PubChem CID 11013029) has the molecular formula C12H21N6O3+ and a molecular weight of 297.34 g/mol. Its IUPAC name is [2-amino-9-(1,3-dihydroxypropan-2-yloxymethyl)purin-6-yl]-trimethylazanium.
| Compound Name | [2-amino-9-(1,3-dihydroxypropan-2-yloxymethyl)purin-6-yl]-trimethylazanium |
|---|---|
| PubChem CID | 11013029 |
| Molecular Formula | C12H21N6O3+ |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | [2-amino-9-(1,3-dihydroxypropan-2-yloxymethyl)purin-6-yl]-trimethylazanium |
| SMILES | C[N+](C)(C)c1nc(N)nc2c1ncn2COC(CO)CO |
| InChI | InChI=1S/C12H21N6O3/c1-18(2,3)11-9-10(15-12(13)16-11)17(6-14-9)7-21-8(4-19)5-20/h6,8,19-20H,4-5,7H2,1-3H3,(H2,13,15,16)/q+1 |
| InChIKey | DIEFEGRVXPBUSU-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|