C15H16ClN5O4 — CID 135745173
2-amino-9-[[1-(4-chlorophenoxy)-3-hydroxypropan-2-yl]oxymethyl]-1H-purin-6-one (PubChem CID 135745173) has the molecular formula C15H16ClN5O4 and a molecular weight of 365.78 g/mol. Its IUPAC name is 2-amino-9-[[1-(4-chlorophenoxy)-3-hydroxypropan-2-yl]oxymethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[[1-(4-chlorophenoxy)-3-hydroxypropan-2-yl]oxymethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135745173 |
| Molecular Formula | C15H16ClN5O4 |
| Molecular Weight | 365.78 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 2-amino-9-[[1-(4-chlorophenoxy)-3-hydroxypropan-2-yl]oxymethyl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2COC(CO)COc2ccc(Cl)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C15H16ClN5O4/c16-9-1-3-10(4-2-9)24-6-11(5-22)25-8-21-7-18-12-13(21)19-15(17)20-14(12)23/h1-4,7,11,22H,5-6,8H2,(H3,17,19,20,23) |
| InChIKey | GOWFIFQAUMYZRU-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.78 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |