C10H16N5O6P — CID 173361717
2-amino-9-[(1-hydroxy-4-phosphonatobutan-2-yl)oxymethyl]-1H-purin-6-one;hydron (PubChem CID 173361717) has the molecular formula C10H16N5O6P and a molecular weight of 333.24 g/mol. Its IUPAC name is 2-amino-9-[(1-hydroxy-4-phosphonatobutan-2-yl)oxymethyl]-1H-purin-6-one;hydron.
| Compound Name | 2-amino-9-[(1-hydroxy-4-phosphonatobutan-2-yl)oxymethyl]-1H-purin-6-one;hydron |
|---|---|
| PubChem CID | 173361717 |
| Molecular Formula | C10H16N5O6P |
| Molecular Weight | 333.24 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 2-amino-9-[(1-hydroxy-4-phosphonatobutan-2-yl)oxymethyl]-1H-purin-6-one;hydron |
| SMILES | Nc1nc2c(ncn2COC(CO)CCP(=O)([O-])[O-])c(=O)[nH]1.[H+].[H+] |
| InChI | InChI=1S/C10H16N5O6P/c11-10-13-8-7(9(17)14-10)12-4-15(8)5-21-6(3-16)1-2-22(18,19)20/h4,6,16H,1-3,5H2,(H2,18,19,20)(H3,11,13,14,17) |
| InChIKey | QVNXYSKNFUJRMI-UHFFFAOYSA-N |
| XLogP | -2.43 |
| TPSA | 182.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.24 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|