C14H24N5O6P — CID 135531228
2-amino-9-[[(2R)-4-diethoxyphosphoryl-1-hydroxybutan-2-yl]oxymethyl]-1H-purin-6-one (PubChem CID 135531228) has the molecular formula C14H24N5O6P and a molecular weight of 389.35 g/mol. Its IUPAC name is 2-amino-9-[[(2R)-4-diethoxyphosphoryl-1-hydroxybutan-2-yl]oxymethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[[(2R)-4-diethoxyphosphoryl-1-hydroxybutan-2-yl]oxymethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135531228 |
| Molecular Formula | C14H24N5O6P |
| Molecular Weight | 389.35 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 2-amino-9-[[(2R)-4-diethoxyphosphoryl-1-hydroxybutan-2-yl]oxymethyl]-1H-purin-6-one |
| SMILES | CCOP(=O)(CC[C@H](CO)OCn1cnc2c(=O)[nH]c(N)nc21)OCC |
| InChI | InChI=1S/C14H24N5O6P/c1-3-24-26(22,25-4-2)6-5-10(7-20)23-9-19-8-16-11-12(19)17-14(15)18-13(11)21/h8,10,20H,3-7,9H2,1-2H3,(H3,15,17,18,21)/t10-/m1/s1 |
| InChIKey | KDVRWINDTUMUNP-SNVBAGLBSA-N |
| XLogP | 0.69 |
| TPSA | 154.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.35 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|