C9H13N5O4 — CID 135398740
2-amino-9-(1,3-dihydroxypropan-2-yloxymethyl)-1H-purin-6-one (PubChem CID 135398740) has the molecular formula C9H13N5O4 and a molecular weight of 255.23 g/mol. Its IUPAC name is 2-amino-9-(1,3-dihydroxypropan-2-yloxymethyl)-1H-purin-6-one.
| Compound Name | 2-amino-9-(1,3-dihydroxypropan-2-yloxymethyl)-1H-purin-6-one |
|---|---|
| PubChem CID | 135398740 |
| Molecular Formula | C9H13N5O4 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 2-amino-9-(1,3-dihydroxypropan-2-yloxymethyl)-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2COC(CO)CO)c(=O)[nH]1 |
| InChI | InChI=1S/C9H13N5O4/c10-9-12-7-6(8(17)13-9)11-3-14(7)4-18-5(1-15)2-16/h3,5,15-16H,1-2,4H2,(H3,10,12,13,17) |
| InChIKey | IRSCQMHQWWYFCW-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |