C14H15N5O3 — CID 135407739
2-amino-9-[[(1S)-2-hydroxy-1-phenylethoxy]methyl]-1H-purin-6-one (PubChem CID 135407739) has the molecular formula C14H15N5O3 and a molecular weight of 301.31 g/mol. Its IUPAC name is 2-amino-9-[[(1S)-2-hydroxy-1-phenylethoxy]methyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[[(1S)-2-hydroxy-1-phenylethoxy]methyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135407739 |
| Molecular Formula | C14H15N5O3 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2-amino-9-[[(1S)-2-hydroxy-1-phenylethoxy]methyl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2CO[C@H](CO)c2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C14H15N5O3/c15-14-17-12-11(13(21)18-14)16-7-19(12)8-22-10(6-20)9-4-2-1-3-5-9/h1-5,7,10,20H,6,8H2,(H3,15,17,18,21)/t10-/m1/s1 |
| InChIKey | JOTQXBNKAXDDSQ-SNVBAGLBSA-N |
| XLogP | 0.41 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |