C14H16N5O5P — CID 135409020
[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxy-phenylmethyl]phosphonic acid (PubChem CID 135409020) has the molecular formula C14H16N5O5P and a molecular weight of 365.29 g/mol. Its IUPAC name is [2-(2-amino-6-oxo-1H-purin-9-yl)ethoxy-phenylmethyl]phosphonic acid.
| Compound Name | [2-(2-amino-6-oxo-1H-purin-9-yl)ethoxy-phenylmethyl]phosphonic acid |
|---|---|
| PubChem CID | 135409020 |
| Molecular Formula | C14H16N5O5P |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | [2-(2-amino-6-oxo-1H-purin-9-yl)ethoxy-phenylmethyl]phosphonic acid |
| SMILES | Nc1nc2c(ncn2CCOC(c2ccccc2)P(=O)(O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C14H16N5O5P/c15-14-17-11-10(12(20)18-14)16-8-19(11)6-7-24-13(25(21,22)23)9-4-2-1-3-5-9/h1-5,8,13H,6-7H2,(H2,21,22,23)(H3,15,17,18,20) |
| InChIKey | OISPJFGZCCKKTI-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 156.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|