C9H14N5O4P — CID 135972449
4-(2-amino-6-oxo-1H-purin-9-yl)butylphosphonic acid (PubChem CID 135972449) has the molecular formula C9H14N5O4P and a molecular weight of 287.22 g/mol. Its IUPAC name is 4-(2-amino-6-oxo-1H-purin-9-yl)butylphosphonic acid.
| Compound Name | 4-(2-amino-6-oxo-1H-purin-9-yl)butylphosphonic acid |
|---|---|
| PubChem CID | 135972449 |
| Molecular Formula | C9H14N5O4P |
| Molecular Weight | 287.22 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 4-(2-amino-6-oxo-1H-purin-9-yl)butylphosphonic acid |
| SMILES | Nc1nc2c(ncn2CCCCP(=O)(O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C9H14N5O4P/c10-9-12-7-6(8(15)13-9)11-5-14(7)3-1-2-4-19(16,17)18/h5H,1-4H2,(H2,16,17,18)(H3,10,12,13,15) |
| InChIKey | UYWGTMUIXYERMZ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 147.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.22 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|