C10H16N5O5P — CID 135795210
[3-[(2-amino-6-oxo-1H-purin-9-yl)methyl]-4-hydroxybutyl]phosphonic acid (PubChem CID 135795210) has the molecular formula C10H16N5O5P and a molecular weight of 317.24 g/mol. Its IUPAC name is [3-[(2-amino-6-oxo-1H-purin-9-yl)methyl]-4-hydroxybutyl]phosphonic acid.
| Compound Name | [3-[(2-amino-6-oxo-1H-purin-9-yl)methyl]-4-hydroxybutyl]phosphonic acid |
|---|---|
| PubChem CID | 135795210 |
| Molecular Formula | C10H16N5O5P |
| Molecular Weight | 317.24 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | [3-[(2-amino-6-oxo-1H-purin-9-yl)methyl]-4-hydroxybutyl]phosphonic acid |
| SMILES | Nc1nc2c(ncn2CC(CO)CCP(=O)(O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C10H16N5O5P/c11-10-13-8-7(9(17)14-10)12-5-15(8)3-6(4-16)1-2-21(18,19)20/h5-6,16H,1-4H2,(H2,18,19,20)(H3,11,13,14,17) |
| InChIKey | KUUCIJSHODOCBE-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 167.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.24 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|