C16H20N5O5P — CID 135531236
[(1S,3R)-3-[(2-amino-6-oxo-1H-purin-9-yl)methyl]-4-hydroxy-1-phenylbutyl]phosphonic acid (PubChem CID 135531236) has the molecular formula C16H20N5O5P and a molecular weight of 393.34 g/mol. Its IUPAC name is [(1S,3R)-3-[(2-amino-6-oxo-1H-purin-9-yl)methyl]-4-hydroxy-1-phenylbutyl]phosphonic acid.
| Compound Name | [(1S,3R)-3-[(2-amino-6-oxo-1H-purin-9-yl)methyl]-4-hydroxy-1-phenylbutyl]phosphonic acid |
|---|---|
| PubChem CID | 135531236 |
| Molecular Formula | C16H20N5O5P |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | [(1S,3R)-3-[(2-amino-6-oxo-1H-purin-9-yl)methyl]-4-hydroxy-1-phenylbutyl]phosphonic acid |
| SMILES | Nc1nc2c(ncn2C[C@H](CO)C[C@@H](c2ccccc2)P(=O)(O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C16H20N5O5P/c17-16-19-14-13(15(23)20-16)18-9-21(14)7-10(8-22)6-12(27(24,25)26)11-4-2-1-3-5-11/h1-5,9-10,12,22H,6-8H2,(H2,24,25,26)(H3,17,19,20,23)/t10-,12+/m1/s1 |
| InChIKey | LDONEGMWBLHASZ-PWSUYJOCSA-N |
| XLogP | 0.62 |
| TPSA | 167.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|