C9H15N6O4P — CID 136928955
[(2R)-1-(2-amino-6-oxo-1H-purin-9-yl)propan-2-yl]oxymethylphosphonamidic acid (PubChem CID 136928955) has the molecular formula C9H15N6O4P and a molecular weight of 302.23 g/mol. Its IUPAC name is [(2R)-1-(2-amino-6-oxo-1H-purin-9-yl)propan-2-yl]oxymethylphosphonamidic acid.
| Compound Name | [(2R)-1-(2-amino-6-oxo-1H-purin-9-yl)propan-2-yl]oxymethylphosphonamidic acid |
|---|---|
| PubChem CID | 136928955 |
| Molecular Formula | C9H15N6O4P |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | [(2R)-1-(2-amino-6-oxo-1H-purin-9-yl)propan-2-yl]oxymethylphosphonamidic acid |
| SMILES | C[C@H](Cn1cnc2c(=O)[nH]c(N)nc21)OCP(N)(=O)O |
| InChI | InChI=1S/C9H15N6O4P/c1-5(19-4-20(11,17)18)2-15-3-12-6-7(15)13-9(10)14-8(6)16/h3,5H,2,4H2,1H3,(H3,11,17,18)(H3,10,13,14,16)/t5-/m1/s1 |
| InChIKey | RZFDEZVXLYVYBB-RXMQYKEDSA-N |
| XLogP | -0.79 |
| TPSA | 162.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|