C9H14N5O4PS — CID 18765100
1-(2-amino-6-sulfanylidene-3H-purin-9-yl)propan-2-yloxymethylphosphonic acid (PubChem CID 18765100) has the molecular formula C9H14N5O4PS and a molecular weight of 319.28 g/mol. Its IUPAC name is 1-(2-amino-6-sulfanylidene-3H-purin-9-yl)propan-2-yloxymethylphosphonic acid.
| Compound Name | 1-(2-amino-6-sulfanylidene-3H-purin-9-yl)propan-2-yloxymethylphosphonic acid |
|---|---|
| PubChem CID | 18765100 |
| Molecular Formula | C9H14N5O4PS |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 1-(2-amino-6-sulfanylidene-3H-purin-9-yl)propan-2-yloxymethylphosphonic acid |
| SMILES | CC(Cn1cnc2c(=S)nc(N)[nH]c21)OCP(=O)(O)O |
| InChI | InChI=1S/C9H14N5O4PS/c1-5(18-4-19(15,16)17)2-14-3-11-6-7(14)12-9(10)13-8(6)20/h3,5H,2,4H2,1H3,(H2,15,16,17)(H3,10,12,13,20) |
| InChIKey | IAFONVIGGMKJMK-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|