C7H10N6S — CID 155082896
2-amino-9-(1-aminoethyl)-3H-purine-6-thione (PubChem CID 155082896) has the molecular formula C7H10N6S and a molecular weight of 210.27 g/mol. Its IUPAC name is 2-amino-9-(1-aminoethyl)-3H-purine-6-thione.
| Compound Name | 2-amino-9-(1-aminoethyl)-3H-purine-6-thione |
|---|---|
| PubChem CID | 155082896 |
| Molecular Formula | C7H10N6S |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 2-amino-9-(1-aminoethyl)-3H-purine-6-thione |
| SMILES | CC(N)n1cnc2c(=S)nc(N)[nH]c21 |
| InChI | InChI=1S/C7H10N6S/c1-3(8)13-2-10-4-5(13)11-7(9)12-6(4)14/h2-3H,8H2,1H3,(H3,9,11,12,14) |
| InChIKey | WCSCZAHVVCNRKJ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|