C10H9N7OS2 — CID 91199130
1-(2-amino-6-sulfanylidene-3H-purin-9-yl)-5-methyl-4-sulfanylidenepyrimidin-2-one (PubChem CID 91199130) has the molecular formula C10H9N7OS2 and a molecular weight of 307.36 g/mol. Its IUPAC name is 1-(2-amino-6-sulfanylidene-3H-purin-9-yl)-5-methyl-4-sulfanylidenepyrimidin-2-one.
| Compound Name | 1-(2-amino-6-sulfanylidene-3H-purin-9-yl)-5-methyl-4-sulfanylidenepyrimidin-2-one |
|---|---|
| PubChem CID | 91199130 |
| Molecular Formula | C10H9N7OS2 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 1-(2-amino-6-sulfanylidene-3H-purin-9-yl)-5-methyl-4-sulfanylidenepyrimidin-2-one |
| SMILES | Cc1cn(-n2cnc3c(=S)nc(N)[nH]c32)c(=O)[nH]c1=S |
| InChI | InChI=1S/C10H9N7OS2/c1-4-2-16(10(18)15-7(4)19)17-3-12-5-6(17)13-9(11)14-8(5)20/h2-3H,1H3,(H,15,18,19)(H3,11,13,14,20) |
| InChIKey | KGHVFPRHXYVVNR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 110.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|