C11H14N5O4PS — CID 166881167
9-[(4aR,6R,7aS)-2-methyl-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-3H-purine-6-thione (PubChem CID 166881167) has the molecular formula C11H14N5O4PS and a molecular weight of 343.31 g/mol. Its IUPAC name is 9-[(4aR,6R,7aS)-2-methyl-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-3H-purine-6-thione.
| Compound Name | 9-[(4aR,6R,7aS)-2-methyl-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-3H-purine-6-thione |
|---|---|
| PubChem CID | 166881167 |
| Molecular Formula | C11H14N5O4PS |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 9-[(4aR,6R,7aS)-2-methyl-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-3H-purine-6-thione |
| SMILES | CP1(=O)OC[C@H]2O[C@@H](n3cnc4c(=S)nc(N)[nH]c43)C[C@@H]2O1 |
| InChI | InChI=1S/C11H14N5O4PS/c1-21(17)18-3-6-5(20-21)2-7(19-6)16-4-13-8-9(16)14-11(12)15-10(8)22/h4-7H,2-3H2,1H3,(H3,12,14,15,22)/t5-,6+,7+,21?/m0/s1 |
| InChIKey | KUXPGTSNVQQXFZ-QWEIFEMGSA-N |
| XLogP | 1.60 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|