C11H15N5O3S — CID 87824975
2-amino-9-[(2R,5R)-5-ethyl-3,4-dihydroxyoxolan-2-yl]-3H-purine-6-thione (PubChem CID 87824975) has the molecular formula C11H15N5O3S and a molecular weight of 297.34 g/mol. Its IUPAC name is 2-amino-9-[(2R,5R)-5-ethyl-3,4-dihydroxyoxolan-2-yl]-3H-purine-6-thione.
| Compound Name | 2-amino-9-[(2R,5R)-5-ethyl-3,4-dihydroxyoxolan-2-yl]-3H-purine-6-thione |
|---|---|
| PubChem CID | 87824975 |
| Molecular Formula | C11H15N5O3S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 2-amino-9-[(2R,5R)-5-ethyl-3,4-dihydroxyoxolan-2-yl]-3H-purine-6-thione |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(=S)nc(N)[nH]c32)C(O)C1O |
| InChI | InChI=1S/C11H15N5O3S/c1-2-4-6(17)7(18)10(19-4)16-3-13-5-8(16)14-11(12)15-9(5)20/h3-4,6-7,10,17-18H,2H2,1H3,(H3,12,14,15,20)/t4-,6?,7?,10-/m1/s1 |
| InChIKey | MDDJMEGQYCAVBH-DGPXGRDGSA-N |
| XLogP | 0.10 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|