C15H23N4O3PS — CID 90276030
9-[(2R,3R,4S)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-2-methyl-3H-purine-6-thione (PubChem CID 90276030) has the molecular formula C15H23N4O3PS and a molecular weight of 370.42 g/mol. Its IUPAC name is 9-[(2R,3R,4S)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-2-methyl-3H-purine-6-thione.
| Compound Name | 9-[(2R,3R,4S)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-2-methyl-3H-purine-6-thione |
|---|---|
| PubChem CID | 90276030 |
| Molecular Formula | C15H23N4O3PS |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 9-[(2R,3R,4S)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-2-methyl-3H-purine-6-thione |
| SMILES | C=P(C)(C)CCC1O[C@@H](n2cnc3c(=S)nc(C)[nH]c32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H23N4O3PS/c1-8-17-13-10(14(24)18-8)16-7-19(13)15-12(21)11(20)9(22-15)5-6-23(2,3)4/h7,9,11-12,15,20-21H,2,5-6H2,1,3-4H3,(H,17,18,24)/t9?,11-,12-,15-/m1/s1 |
| InChIKey | NHDXYNQSIUNVAB-MSJRJPAQSA-N |
| XLogP | 1.52 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|