C14H23N2O4PS — CID 90180791
1-[(2R,3R,4S,5R)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-5-methyl-2-sulfanylidenepyrimidin-4-one (PubChem CID 90180791) has the molecular formula C14H23N2O4PS and a molecular weight of 346.39 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-5-methyl-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-[(2R,3R,4S,5R)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-5-methyl-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 90180791 |
| Molecular Formula | C14H23N2O4PS |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-5-methyl-2-sulfanylidenepyrimidin-4-one |
| SMILES | C=P(C)(C)CC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=S)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H23N2O4PS/c1-8-7-16(14(22)15-12(8)19)13-11(18)10(17)9(20-13)5-6-21(2,3)4/h7,9-11,13,17-18H,2,5-6H2,1,3-4H3,(H,15,19,22)/t9-,10-,11-,13-/m1/s1 |
| InChIKey | DZEMCNOKHDXZHI-PRULPYPASA-N |
| XLogP | 0.93 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|