C13H23N3O5P+ — CID 160875388
1-[(2R,3R,4S,5R)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-5-methyl-1,3,5-triazin-5-ium-2,4-dione (PubChem CID 160875388) has the molecular formula C13H23N3O5P+ and a molecular weight of 332.32 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-5-methyl-1,3,5-triazin-5-ium-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-5-methyl-1,3,5-triazin-5-ium-2,4-dione |
|---|---|
| PubChem CID | 160875388 |
| Molecular Formula | C13H23N3O5P+ |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-5-methyl-1,3,5-triazin-5-ium-2,4-dione |
| SMILES | C=P(C)(C)CC[C@H]1O[C@@H](n2c[n+](C)c(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H22N3O5P/c1-15-7-16(13(20)14-12(15)19)11-10(18)9(17)8(21-11)5-6-22(2,3)4/h7-11,17-18H,2,5-6H2,1,3-4H3/p+1/t8-,9-,10-,11-/m1/s1 |
| InChIKey | QKNFYIRZOXZBHP-GWOFURMSSA-O |
| XLogP | -1.92 |
| TPSA | 108.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|