C16H25N2O5P — CID 118682055
1-[(3R,4S)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-5-prop-2-enylpyrimidine-2,4-dione (PubChem CID 118682055) has the molecular formula C16H25N2O5P and a molecular weight of 356.36 g/mol. Its IUPAC name is 1-[(3R,4S)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-5-prop-2-enylpyrimidine-2,4-dione.
| Compound Name | 1-[(3R,4S)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-5-prop-2-enylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118682055 |
| Molecular Formula | C16H25N2O5P |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 1-[(3R,4S)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-5-prop-2-enylpyrimidine-2,4-dione |
| SMILES | C=CCc1cn(C2OC(CCP(=C)(C)C)[C@@H](O)[C@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H25N2O5P/c1-5-6-10-9-18(16(22)17-14(10)21)15-13(20)12(19)11(23-15)7-8-24(2,3)4/h5,9,11-13,15,19-20H,1-2,6-8H2,3-4H3,(H,17,21,22)/t11?,12-,13-,15?/m1/s1 |
| InChIKey | KBKGFIZPZOXAFH-DNCHLWJUSA-N |
| XLogP | -0.02 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|