C19H32N3O4PS — CID 118682036
1-[(3R,4S)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-5-[(3-methylbut-2-enylamino)methyl]-2-sulfanylidenepyrimidin-4-one (PubChem CID 118682036) has the molecular formula C19H32N3O4PS and a molecular weight of 429.52 g/mol. Its IUPAC name is 1-[(3R,4S)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-5-[(3-methylbut-2-enylamino)methyl]-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-[(3R,4S)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-5-[(3-methylbut-2-enylamino)methyl]-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 118682036 |
| Molecular Formula | C19H32N3O4PS |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 1-[(3R,4S)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-5-[(3-methylbut-2-enylamino)methyl]-2-sulfanylidenepyrimidin-4-one |
| SMILES | C=P(C)(C)CCC1OC(n2cc(CNCC=C(C)C)c(=O)[nH]c2=S)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H32N3O4PS/c1-12(2)6-8-20-10-13-11-22(19(28)21-17(13)25)18-16(24)15(23)14(26-18)7-9-27(3,4)5/h6,11,14-16,18,20,23-24H,3,7-10H2,1-2,4-5H3,(H,21,25,28)/t14?,15-,16-,18?/m1/s1 |
| InChIKey | VPCPLYQIDZRBLW-GARNVTTQSA-N |
| XLogP | 1.68 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|