C17H30N3O5P — CID 122592751
1-[(2R,3R,4S)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-5-(propylaminomethyl)pyrimidine-2,4-dione (PubChem CID 122592751) has the molecular formula C17H30N3O5P and a molecular weight of 387.42 g/mol. Its IUPAC name is 1-[(2R,3R,4S)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-5-(propylaminomethyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-5-(propylaminomethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 122592751 |
| Molecular Formula | C17H30N3O5P |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 1-[(2R,3R,4S)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-5-(propylaminomethyl)pyrimidine-2,4-dione |
| SMILES | C=P(C)(C)CCC1O[C@@H](n2cc(CNCCC)c(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H30N3O5P/c1-5-7-18-9-11-10-20(17(24)19-15(11)23)16-14(22)13(21)12(25-16)6-8-26(2,3)4/h10,12-14,16,18,21-22H,2,5-9H2,1,3-4H3,(H,19,23,24)/t12?,13-,14-,16-/m1/s1 |
| InChIKey | ATLVAJZLXOXTSH-QAJQFAIVSA-N |
| XLogP | -0.25 |
| TPSA | 116.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|