C15H23N4O3PS — CID 158597722
2-amino-7-[(3R,4S,5R)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-1H-pyrrolo[2,3-d]pyrimidine-4-thione (PubChem CID 158597722) has the molecular formula C15H23N4O3PS and a molecular weight of 370.42 g/mol. Its IUPAC name is 2-amino-7-[(3R,4S,5R)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-1H-pyrrolo[2,3-d]pyrimidine-4-thione.
| Compound Name | 2-amino-7-[(3R,4S,5R)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-1H-pyrrolo[2,3-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 158597722 |
| Molecular Formula | C15H23N4O3PS |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2-amino-7-[(3R,4S,5R)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-1H-pyrrolo[2,3-d]pyrimidine-4-thione |
| SMILES | C=P(C)(C)CC[C@H]1OC(n2ccc3c(=S)nc(N)[nH]c32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H23N4O3PS/c1-23(2,3)7-5-9-10(20)11(21)14(22-9)19-6-4-8-12(19)17-15(16)18-13(8)24/h4,6,9-11,14,20-21H,1,5,7H2,2-3H3,(H3,16,17,18,24)/t9-,10-,11-,14?/m1/s1 |
| InChIKey | JJLQNJRCIQKXCJ-POGOCJABSA-N |
| XLogP | 1.39 |
| TPSA | 109.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|