C14H23IN3O3P — CID 158348128
2-(4-amino-5-iodo-2-methylidenepyrimidin-1-yl)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]oxolane-3,4-diol (PubChem CID 158348128) has the molecular formula C14H23IN3O3P and a molecular weight of 439.23 g/mol. Its IUPAC name is 2-(4-amino-5-iodo-2-methylidenepyrimidin-1-yl)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]oxolane-3,4-diol.
| Compound Name | 2-(4-amino-5-iodo-2-methylidenepyrimidin-1-yl)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 158348128 |
| Molecular Formula | C14H23IN3O3P |
| Molecular Weight | 439.23 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | 2-(4-amino-5-iodo-2-methylidenepyrimidin-1-yl)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]oxolane-3,4-diol |
| SMILES | C=C1N=C(N)C(I)=CN1C1OC(CCP(=C)(C)C)C(O)C1O |
| InChI | InChI=1S/C14H23IN3O3P/c1-8-17-13(16)9(15)7-18(8)14-12(20)11(19)10(21-14)5-6-22(2,3)4/h7,10-12,14,19-20H,1-2,5-6H2,3-4H3,(H2,16,17) |
| InChIKey | WRBOEVJFVLSEOQ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|