C14H23BrN3O2P — CID 90275968
(3R,4R,5R)-5-(4-amino-2-methylidenepyrimidin-1-yl)-4-bromo-2-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]oxolan-3-ol (PubChem CID 90275968) has the molecular formula C14H23BrN3O2P and a molecular weight of 376.24 g/mol. Its IUPAC name is (3R,4R,5R)-5-(4-amino-2-methylidenepyrimidin-1-yl)-4-bromo-2-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]oxolan-3-ol.
| Compound Name | (3R,4R,5R)-5-(4-amino-2-methylidenepyrimidin-1-yl)-4-bromo-2-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]oxolan-3-ol |
|---|---|
| PubChem CID | 90275968 |
| Molecular Formula | C14H23BrN3O2P |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | (3R,4R,5R)-5-(4-amino-2-methylidenepyrimidin-1-yl)-4-bromo-2-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]oxolan-3-ol |
| SMILES | C=C1N=C(N)C=CN1[C@@H]1OC(CCP(=C)(C)C)[C@@H](O)[C@H]1Br |
| InChI | InChI=1S/C14H23BrN3O2P/c1-9-17-11(16)5-7-18(9)14-12(15)13(19)10(20-14)6-8-21(2,3)4/h5,7,10,12-14,19H,1-2,6,8H2,3-4H3,(H2,16,17)/t10?,12-,13-,14-/m1/s1 |
| InChIKey | WWNXUTSUNKRYLN-FYFXECOGSA-N |
| XLogP | 1.59 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|