C15H22BrN4O2P — CID 129128394
(3R,4R)-5-(7-aminoimidazo[4,5-b]pyridin-3-yl)-4-bromo-2-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]oxolan-3-ol (PubChem CID 129128394) has the molecular formula C15H22BrN4O2P and a molecular weight of 401.25 g/mol. Its IUPAC name is (3R,4R)-5-(7-aminoimidazo[4,5-b]pyridin-3-yl)-4-bromo-2-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]oxolan-3-ol.
| Compound Name | (3R,4R)-5-(7-aminoimidazo[4,5-b]pyridin-3-yl)-4-bromo-2-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]oxolan-3-ol |
|---|---|
| PubChem CID | 129128394 |
| Molecular Formula | C15H22BrN4O2P |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | (3R,4R)-5-(7-aminoimidazo[4,5-b]pyridin-3-yl)-4-bromo-2-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]oxolan-3-ol |
| SMILES | C=P(C)(C)CCC1OC(n2cnc3c(N)ccnc32)[C@H](Br)[C@@H]1O |
| InChI | InChI=1S/C15H22BrN4O2P/c1-23(2,3)7-5-10-13(21)11(16)15(22-10)20-8-19-12-9(17)4-6-18-14(12)20/h4,6,8,10-11,13,15,21H,1,5,7H2,2-3H3,(H2,17,18)/t10?,11-,13-,15?/m1/s1 |
| InChIKey | BRBRTELEZMDNKS-GDQVSHSTSA-N |
| XLogP | 2.13 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|