C17H28N5O3P — CID 159260197
(2R,3R,4R)-5-(6-amino-2-ethylpurin-9-yl)-2-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-4-methoxyoxolan-3-ol (PubChem CID 159260197) has the molecular formula C17H28N5O3P and a molecular weight of 381.42 g/mol. Its IUPAC name is (2R,3R,4R)-5-(6-amino-2-ethylpurin-9-yl)-2-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-4-methoxyoxolan-3-ol.
| Compound Name | (2R,3R,4R)-5-(6-amino-2-ethylpurin-9-yl)-2-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-4-methoxyoxolan-3-ol |
|---|---|
| PubChem CID | 159260197 |
| Molecular Formula | C17H28N5O3P |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | (2R,3R,4R)-5-(6-amino-2-ethylpurin-9-yl)-2-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-4-methoxyoxolan-3-ol |
| SMILES | C=P(C)(C)CC[C@H]1OC(n2cnc3c(N)nc(CC)nc32)[C@H](OC)[C@@H]1O |
| InChI | InChI=1S/C17H28N5O3P/c1-6-11-20-15(18)12-16(21-11)22(9-19-12)17-14(24-2)13(23)10(25-17)7-8-26(3,4)5/h9-10,13-14,17,23H,3,6-8H2,1-2,4-5H3,(H2,18,20,21)/t10-,13-,14-,17?/m1/s1 |
| InChIKey | IWUUDODKMPKHJJ-NVONZOAYSA-N |
| XLogP | 1.34 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|