C21H40N3O3PSi — CID 159452334
(2R,3R,4S,5R)-2-[4-amino-5-[[tert-butyl(dimethyl)silyl]methyl]-2-methylidenepyrimidin-1-yl]-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]oxolane-3,4-diol (PubChem CID 159452334) has the molecular formula C21H40N3O3PSi and a molecular weight of 441.63 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[4-amino-5-[[tert-butyl(dimethyl)silyl]methyl]-2-methylidenepyrimidin-1-yl]-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[4-amino-5-[[tert-butyl(dimethyl)silyl]methyl]-2-methylidenepyrimidin-1-yl]-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 159452334 |
| Molecular Formula | C21H40N3O3PSi |
| Molecular Weight | 441.63 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | (2R,3R,4S,5R)-2-[4-amino-5-[[tert-butyl(dimethyl)silyl]methyl]-2-methylidenepyrimidin-1-yl]-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]oxolane-3,4-diol |
| SMILES | C=C1N=C(N)C(C[Si](C)(C)C(C)(C)C)=CN1[C@@H]1O[C@H](CCP(=C)(C)C)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H40N3O3PSi/c1-14-23-19(22)15(13-29(8,9)21(2,3)4)12-24(14)20-18(26)17(25)16(27-20)10-11-28(5,6)7/h12,16-18,20,25-26H,1,5,10-11,13H2,2-4,6-9H3,(H2,22,23)/t16-,17-,18-,20-/m1/s1 |
| InChIKey | PVDURIKGZWXBGE-SOAMZJECSA-N |
| XLogP | 3.07 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.63 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|