C17H30N3O4P — CID 159935721
(2R,3R,4S,5R)-2-[4-amino-5-(2-hydroxyethyl)-2-methylidenepyrimidin-1-yl]-5-[1-[dimethyl(methylidene)-λ5-phosphanyl]propan-2-yl]oxolane-3,4-diol (PubChem CID 159935721) has the molecular formula C17H30N3O4P and a molecular weight of 371.42 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[4-amino-5-(2-hydroxyethyl)-2-methylidenepyrimidin-1-yl]-5-[1-[dimethyl(methylidene)-λ5-phosphanyl]propan-2-yl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[4-amino-5-(2-hydroxyethyl)-2-methylidenepyrimidin-1-yl]-5-[1-[dimethyl(methylidene)-λ5-phosphanyl]propan-2-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 159935721 |
| Molecular Formula | C17H30N3O4P |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | (2R,3R,4S,5R)-2-[4-amino-5-(2-hydroxyethyl)-2-methylidenepyrimidin-1-yl]-5-[1-[dimethyl(methylidene)-λ5-phosphanyl]propan-2-yl]oxolane-3,4-diol |
| SMILES | C=C1N=C(N)C(CCO)=CN1[C@@H]1O[C@H](C(C)CP(=C)(C)C)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H30N3O4P/c1-10(9-25(3,4)5)15-13(22)14(23)17(24-15)20-8-12(6-7-21)16(18)19-11(20)2/h8,10,13-15,17,21-23H,2-3,6-7,9H2,1,4-5H3,(H2,18,19)/t10?,13-,14+,15+,17+/m0/s1 |
| InChIKey | XTTQJNQDKOBKQI-BZBPWZSPSA-N |
| XLogP | 0.19 |
| TPSA | 111.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|