C18H29N4O4P — CID 159498039
9-[(2R,3R,4S,5R)-5-[1-[dimethyl(methylidene)-λ5-phosphanyl]propan-2-yl]-3,4-dihydroxyoxolan-2-yl]-8-ethyl-2-methyl-1H-purin-6-one (PubChem CID 159498039) has the molecular formula C18H29N4O4P and a molecular weight of 396.43 g/mol. Its IUPAC name is 9-[(2R,3R,4S,5R)-5-[1-[dimethyl(methylidene)-λ5-phosphanyl]propan-2-yl]-3,4-dihydroxyoxolan-2-yl]-8-ethyl-2-methyl-1H-purin-6-one.
| Compound Name | 9-[(2R,3R,4S,5R)-5-[1-[dimethyl(methylidene)-λ5-phosphanyl]propan-2-yl]-3,4-dihydroxyoxolan-2-yl]-8-ethyl-2-methyl-1H-purin-6-one |
|---|---|
| PubChem CID | 159498039 |
| Molecular Formula | C18H29N4O4P |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 9-[(2R,3R,4S,5R)-5-[1-[dimethyl(methylidene)-λ5-phosphanyl]propan-2-yl]-3,4-dihydroxyoxolan-2-yl]-8-ethyl-2-methyl-1H-purin-6-one |
| SMILES | C=P(C)(C)CC(C)[C@H]1O[C@@H](n2c(CC)nc3c(=O)[nH]c(C)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H29N4O4P/c1-7-11-21-12-16(19-10(3)20-17(12)25)22(11)18-14(24)13(23)15(26-18)9(2)8-27(4,5)6/h9,13-15,18,23-24H,4,7-8H2,1-3,5-6H3,(H,19,20,25)/t9?,13-,14+,15+,18+/m0/s1 |
| InChIKey | OJYYHIDWMLNFMP-SUJYRUOMSA-N |
| XLogP | 0.95 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|