C10H11FN4O4 — CID 141446003
9-(3,4-dihydroxyoxolan-2-yl)-8-fluoro-2-methyl-1H-purin-6-one (PubChem CID 141446003) has the molecular formula C10H11FN4O4 and a molecular weight of 270.22 g/mol. Its IUPAC name is 9-(3,4-dihydroxyoxolan-2-yl)-8-fluoro-2-methyl-1H-purin-6-one.
| Compound Name | 9-(3,4-dihydroxyoxolan-2-yl)-8-fluoro-2-methyl-1H-purin-6-one |
|---|---|
| PubChem CID | 141446003 |
| Molecular Formula | C10H11FN4O4 |
| Molecular Weight | 270.22 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 9-(3,4-dihydroxyoxolan-2-yl)-8-fluoro-2-methyl-1H-purin-6-one |
| SMILES | Cc1nc2c(nc(F)n2C2OCC(O)C2O)c(=O)[nH]1 |
| InChI | InChI=1S/C10H11FN4O4/c1-3-12-7-5(8(18)13-3)14-10(11)15(7)9-6(17)4(16)2-19-9/h4,6,9,16-17H,2H2,1H3,(H,12,13,18) |
| InChIKey | GQXVCJDRWGBLET-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.22 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |