C16H15FN5O6P — CID 174095063
9-[(6R,7S,7aS)-2,7-dihydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-8-(4-fluorophenyl)-1H-purin-6-one (PubChem CID 174095063) has the molecular formula C16H15FN5O6P and a molecular weight of 423.30 g/mol. Its IUPAC name is 9-[(6R,7S,7aS)-2,7-dihydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-8-(4-fluorophenyl)-1H-purin-6-one.
| Compound Name | 9-[(6R,7S,7aS)-2,7-dihydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-8-(4-fluorophenyl)-1H-purin-6-one |
|---|---|
| PubChem CID | 174095063 |
| Molecular Formula | C16H15FN5O6P |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | 9-[(6R,7S,7aS)-2,7-dihydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-8-(4-fluorophenyl)-1H-purin-6-one |
| SMILES | Nc1nc2c(nc(-c3ccc(F)cc3)n2[C@@H]2OC3COP(O)O[C@H]3[C@@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C16H15FN5O6P/c17-7-3-1-6(2-4-7)12-19-9-13(20-16(18)21-14(9)24)22(12)15-10(23)11-8(27-15)5-26-29(25)28-11/h1-4,8,10-11,15,23,25H,5H2,(H3,18,20,21,24)/t8?,10-,11+,15+,29?/m0/s1 |
| InChIKey | XDDYPHROXWDAJB-MAFNNADPSA-N |
| XLogP | 0.40 |
| TPSA | 157.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|