C10H12BrN5O7P+ — CID 135757714
2-amino-8-bromo-9-(2,2,7-trihydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl)-1H-purin-6-one (PubChem CID 135757714) has the molecular formula C10H12BrN5O7P+ and a molecular weight of 425.11 g/mol. Its IUPAC name is 2-amino-8-bromo-9-(2,2,7-trihydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl)-1H-purin-6-one.
| Compound Name | 2-amino-8-bromo-9-(2,2,7-trihydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl)-1H-purin-6-one |
|---|---|
| PubChem CID | 135757714 |
| Molecular Formula | C10H12BrN5O7P+ |
| Molecular Weight | 425.11 g/mol |
| Exact Mass | 423.97 |
| IUPAC Name | 2-amino-8-bromo-9-(2,2,7-trihydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl)-1H-purin-6-one |
| SMILES | Nc1nc2c(nc(Br)n2C2OC3CO[P+](O)(O)OC3C2O)c(=O)[nH]1 |
| InChI | InChI=1S/C10H11BrN5O7P/c11-9-13-3-6(14-10(12)15-7(3)18)16(9)8-4(17)5-2(22-8)1-21-24(19,20)23-5/h2,4-5,8,17,19-20H,1H2,(H2-,12,14,15,18)/p+1 |
| InChIKey | QHIINBDVJJQZNJ-UHFFFAOYSA-O |
| XLogP | -1.20 |
| TPSA | 177.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.11 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|