C10H11BrN5NaO7P — CID 137198964
8-bromo Cyclic GMP (sodium salt) (PubChem CID 137198964) has the molecular formula C10H11BrN5NaO7P and a molecular weight of 447.09 g/mol.
| Compound Name | 8-bromo Cyclic GMP (sodium salt) |
|---|---|
| PubChem CID | 137198964 |
| Molecular Formula | C10H11BrN5NaO7P |
| Molecular Weight | 447.09 g/mol |
| Exact Mass | 445.95 |
| IUPAC Name | — |
| SMILES | Nc1nc2c(nc(Br)n2[C@@H]2O[C@@H]3COP(=O)(O)O[C@H]3[C@H]2O)c(=O)[nH]1.[Na] |
| InChI | InChI=1S/C10H11BrN5O7P.Na/c11-9-13-3-6(14-10(12)15-7(3)18)16(9)8-4(17)5-2(22-8)1-21-24(19,20)23-5;/h2,4-5,8,17H,1H2,(H,19,20)(H3,12,14,15,18);/t2-,4-,5-,8-;/m1./s1 |
| InChIKey | FJAOOACZDYDVJT-YEOHUATISA-N |
| XLogP | -1.14 |
| TPSA | 174.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.09 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|