C10H13BrN5NaO7P — CID 131870794
CID 131870794 (PubChem CID 131870794) has the molecular formula C10H13BrN5NaO7P and a molecular weight of 449.11 g/mol.
| Compound Name | CID 131870794 |
|---|---|
| PubChem CID | 131870794 |
| Molecular Formula | C10H13BrN5NaO7P |
| Molecular Weight | 449.11 g/mol |
| Exact Mass | 447.96 |
| IUPAC Name | — |
| SMILES | Nc1ncnc2c1nc(Br)n2[C@@H]1O[C@@H]2COP(=O)(O)O[C@H]2[C@H]1O.O.[Na] |
| InChI | InChI=1S/C10H11BrN5O6P.Na.H2O/c11-10-15-4-7(12)13-2-14-8(4)16(10)9-5(17)6-3(21-9)1-20-23(18,19)22-6;;/h2-3,5-6,9,17H,1H2,(H,18,19)(H2,12,13,14);;1H2/t3-,5-,6-,9-;;/m1../s1 |
| InChIKey | MIRZWMFYZKOKPK-LGVAUZIVSA-N |
| XLogP | -1.26 |
| TPSA | 186.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.11 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|