C14H14N5O8P — CID 161284402
9-[(6R,7aS)-2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-8-(furan-2-yl)-1H-purin-6-one (PubChem CID 161284402) has the molecular formula C14H14N5O8P and a molecular weight of 411.27 g/mol. Its IUPAC name is 9-[(6R,7aS)-2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-8-(furan-2-yl)-1H-purin-6-one.
| Compound Name | 9-[(6R,7aS)-2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-8-(furan-2-yl)-1H-purin-6-one |
|---|---|
| PubChem CID | 161284402 |
| Molecular Formula | C14H14N5O8P |
| Molecular Weight | 411.27 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 9-[(6R,7aS)-2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-8-(furan-2-yl)-1H-purin-6-one |
| SMILES | Nc1nc2c(nc(-c3ccco3)n2[C@@H]2OC3COP(=O)(O)O[C@H]3C2O)c(=O)[nH]1 |
| InChI | InChI=1S/C14H14N5O8P/c15-14-17-11-7(12(21)18-14)16-10(5-2-1-3-24-5)19(11)13-8(20)9-6(26-13)4-25-28(22,23)27-9/h1-3,6,8-9,13,20H,4H2,(H,22,23)(H3,15,17,18,21)/t6?,8?,9-,13-/m1/s1 |
| InChIKey | BEMILXVDCVROEB-BQYCJVKSSA-N |
| XLogP | -0.26 |
| TPSA | 187.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.27 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|