C20H18N5O9PS — CID 161381335
9-[(6R,7aS)-2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-8-(4-methyl-2-oxochromen-7-yl)sulfanyl-1H-purin-6-one (PubChem CID 161381335) has the molecular formula C20H18N5O9PS and a molecular weight of 535.43 g/mol. Its IUPAC name is 9-[(6R,7aS)-2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-8-(4-methyl-2-oxochromen-7-yl)sulfanyl-1H-purin-6-one.
| Compound Name | 9-[(6R,7aS)-2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-8-(4-methyl-2-oxochromen-7-yl)sulfanyl-1H-purin-6-one |
|---|---|
| PubChem CID | 161381335 |
| Molecular Formula | C20H18N5O9PS |
| Molecular Weight | 535.43 g/mol |
| Exact Mass | 535.06 |
| IUPAC Name | 9-[(6R,7aS)-2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-8-(4-methyl-2-oxochromen-7-yl)sulfanyl-1H-purin-6-one |
| SMILES | Cc1cc(=O)oc2cc(Sc3nc4c(=O)[nH]c(N)nc4n3[C@@H]3OC4COP(=O)(O)O[C@H]4C3O)ccc12 |
| InChI | InChI=1S/C20H18N5O9PS/c1-7-4-12(26)32-10-5-8(2-3-9(7)10)36-20-22-13-16(23-19(21)24-17(13)28)25(20)18-14(27)15-11(33-18)6-31-35(29,30)34-15/h2-5,11,14-15,18,27H,6H2,1H3,(H,29,30)(H3,21,23,24,28)/t11?,14?,15-,18-/m1/s1 |
| InChIKey | NEVGJDDMJCOGEA-LBPZPORJSA-N |
| XLogP | 1.04 |
| TPSA | 205.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.43 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|