C18H19N5O8PS- — CID 162469660
9-[(6R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-8-[(4-methoxyphenyl)methylsulfanyl]-1H-purin-6-one (PubChem CID 162469660) has the molecular formula C18H19N5O8PS- and a molecular weight of 496.42 g/mol. Its IUPAC name is 9-[(6R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-8-[(4-methoxyphenyl)methylsulfanyl]-1H-purin-6-one.
| Compound Name | 9-[(6R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-8-[(4-methoxyphenyl)methylsulfanyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 162469660 |
| Molecular Formula | C18H19N5O8PS- |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 496.07 |
| IUPAC Name | 9-[(6R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-8-[(4-methoxyphenyl)methylsulfanyl]-1H-purin-6-one |
| SMILES | COc1ccc(CSc2nc3c(=O)[nH]c(N)nc3n2[C@@H]2OC3COP(=O)([O-])O[C@H]3C2O)cc1 |
| InChI | InChI=1S/C18H20N5O8PS/c1-28-9-4-2-8(3-5-9)7-33-18-20-11-14(21-17(19)22-15(11)25)23(18)16-12(24)13-10(30-16)6-29-32(26,27)31-13/h2-5,10,12-13,16,24H,6-7H2,1H3,(H,26,27)(H3,19,21,22,25)/p-1/t10?,12?,13-,16-/m1/s1 |
| InChIKey | LYPYNNXKAZSEIW-OSIYLENDSA-M |
| XLogP | 0.14 |
| TPSA | 186.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|