C16H15N5O7P- — CID 157421489
9-[(6R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-8-phenyl-1H-purin-6-one (PubChem CID 157421489) has the molecular formula C16H15N5O7P- and a molecular weight of 420.30 g/mol. Its IUPAC name is 9-[(6R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-8-phenyl-1H-purin-6-one.
| Compound Name | 9-[(6R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-8-phenyl-1H-purin-6-one |
|---|---|
| PubChem CID | 157421489 |
| Molecular Formula | C16H15N5O7P- |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 9-[(6R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-8-phenyl-1H-purin-6-one |
| SMILES | Nc1nc2c(nc(-c3ccccc3)n2[C@@H]2OC3COP(=O)([O-])O[C@H]3C2O)c(=O)[nH]1 |
| InChI | InChI=1S/C16H16N5O7P/c17-16-19-13-9(14(23)20-16)18-12(7-4-2-1-3-5-7)21(13)15-10(22)11-8(27-15)6-26-29(24,25)28-11/h1-5,8,10-11,15,22H,6H2,(H,24,25)(H3,17,19,20,23)/p-1/t8?,10?,11-,15-/m1/s1 |
| InChIKey | NQACNAKZVQWHTF-HTNOARQDSA-M |
| XLogP | -0.49 |
| TPSA | 177.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|