C20H23N5O8PS2- — CID 162469764
9-[(6R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-8-[4-(2-ethoxyethylsulfanyl)phenyl]sulfanyl-1H-purin-6-one (PubChem CID 162469764) has the molecular formula C20H23N5O8PS2- and a molecular weight of 556.54 g/mol. Its IUPAC name is 9-[(6R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-8-[4-(2-ethoxyethylsulfanyl)phenyl]sulfanyl-1H-purin-6-one.
| Compound Name | 9-[(6R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-8-[4-(2-ethoxyethylsulfanyl)phenyl]sulfanyl-1H-purin-6-one |
|---|---|
| PubChem CID | 162469764 |
| Molecular Formula | C20H23N5O8PS2- |
| Molecular Weight | 556.54 g/mol |
| Exact Mass | 556.07 |
| IUPAC Name | 9-[(6R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-8-[4-(2-ethoxyethylsulfanyl)phenyl]sulfanyl-1H-purin-6-one |
| SMILES | CCOCCSc1ccc(Sc2nc3c(=O)[nH]c(N)nc3n2[C@@H]2OC3COP(=O)([O-])O[C@H]3C2O)cc1 |
| InChI | InChI=1S/C20H24N5O8PS2/c1-2-30-7-8-35-10-3-5-11(6-4-10)36-20-22-13-16(23-19(21)24-17(13)27)25(20)18-14(26)15-12(32-18)9-31-34(28,29)33-15/h3-6,12,14-15,18,26H,2,7-9H2,1H3,(H,28,29)(H3,21,23,24,27)/p-1/t12?,14?,15-,18-/m1/s1 |
| InChIKey | JOSVJLRASKIOAA-LJIJDPQTSA-M |
| XLogP | 1.12 |
| TPSA | 186.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.54 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|