C12H14N8O7PS- — CID 162469668
9-[(6R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-8-(2-azidoethylsulfanyl)-1H-purin-6-one (PubChem CID 162469668) has the molecular formula C12H14N8O7PS- and a molecular weight of 445.33 g/mol. Its IUPAC name is 9-[(6R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-8-(2-azidoethylsulfanyl)-1H-purin-6-one.
| Compound Name | 9-[(6R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-8-(2-azidoethylsulfanyl)-1H-purin-6-one |
|---|---|
| PubChem CID | 162469668 |
| Molecular Formula | C12H14N8O7PS- |
| Molecular Weight | 445.33 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | 9-[(6R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-8-(2-azidoethylsulfanyl)-1H-purin-6-one |
| SMILES | [N-]=[N+]=NCCSc1nc2c(=O)[nH]c(N)nc2n1[C@@H]1OC2COP(=O)([O-])O[C@H]2C1O |
| InChI | InChI=1S/C12H15N8O7PS/c13-11-17-8-5(9(22)18-11)16-12(29-2-1-15-19-14)20(8)10-6(21)7-4(26-10)3-25-28(23,24)27-7/h4,6-7,10,21H,1-3H2,(H,23,24)(H3,13,17,18,22)/p-1/t4?,6?,7-,10-/m1/s1 |
| InChIKey | LKDRBHBNKLZNCC-ASZQYJTCSA-M |
| XLogP | -0.75 |
| TPSA | 226.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.33 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|