C28H22N5O8PS — CID 174095071
3-[(6R,7S,7aS)-2,7-dihydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-(4-methyl-2-oxochromen-7-yl)sulfanyl-6-phenyl-5H-imidazo[1,2-a]purin-9-one (PubChem CID 174095071) has the molecular formula C28H22N5O8PS and a molecular weight of 619.55 g/mol. Its IUPAC name is 3-[(6R,7S,7aS)-2,7-dihydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-(4-methyl-2-oxochromen-7-yl)sulfanyl-6-phenyl-5H-imidazo[1,2-a]purin-9-one.
| Compound Name | 3-[(6R,7S,7aS)-2,7-dihydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-(4-methyl-2-oxochromen-7-yl)sulfanyl-6-phenyl-5H-imidazo[1,2-a]purin-9-one |
|---|---|
| PubChem CID | 174095071 |
| Molecular Formula | C28H22N5O8PS |
| Molecular Weight | 619.55 g/mol |
| Exact Mass | 619.09 |
| IUPAC Name | 3-[(6R,7S,7aS)-2,7-dihydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-(4-methyl-2-oxochromen-7-yl)sulfanyl-6-phenyl-5H-imidazo[1,2-a]purin-9-one |
| SMILES | Cc1cc(=O)oc2cc(Sc3nc4c(=O)n5cc(-c6ccccc6)[nH]c5nc4n3[C@@H]3OC4COP(O)O[C@H]4[C@@H]3O)ccc12 |
| InChI | InChI=1S/C28H22N5O8PS/c1-13-9-20(34)39-18-10-15(7-8-16(13)18)43-28-30-21-24(33(28)26-22(35)23-19(40-26)12-38-42(37)41-23)31-27-29-17(11-32(27)25(21)36)14-5-3-2-4-6-14/h2-11,19,22-23,26,35,37H,12H2,1H3,(H,29,31)/t19?,22-,23+,26+,42?/m0/s1 |
| InChIKey | LXAPOSDANBIMCT-ZVNDTEBPSA-N |
| XLogP | 3.50 |
| TPSA | 166.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.55 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|