C17H17BrN5O6P — CID 174095114
9-[(6R,7S,7aS)-2,7-dihydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-1-benzyl-8-bromopurin-6-one (PubChem CID 174095114) has the molecular formula C17H17BrN5O6P and a molecular weight of 498.23 g/mol. Its IUPAC name is 9-[(6R,7S,7aS)-2,7-dihydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-1-benzyl-8-bromopurin-6-one.
| Compound Name | 9-[(6R,7S,7aS)-2,7-dihydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-1-benzyl-8-bromopurin-6-one |
|---|---|
| PubChem CID | 174095114 |
| Molecular Formula | C17H17BrN5O6P |
| Molecular Weight | 498.23 g/mol |
| Exact Mass | 497.01 |
| IUPAC Name | 9-[(6R,7S,7aS)-2,7-dihydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-1-benzyl-8-bromopurin-6-one |
| SMILES | Nc1nc2c(nc(Br)n2[C@@H]2OC3COP(O)O[C@H]3[C@@H]2O)c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C17H17BrN5O6P/c18-16-20-10-13(21-17(19)22(14(10)25)6-8-4-2-1-3-5-8)23(16)15-11(24)12-9(28-15)7-27-30(26)29-12/h1-5,9,11-12,15,24,26H,6-7H2,(H2,19,21)/t9?,11-,12+,15+,30?/m0/s1 |
| InChIKey | PJNYWYKBWMWKKL-FPEZBGKJSA-N |
| XLogP | 0.88 |
| TPSA | 146.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.23 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|