C24H19N5NaO7PS — CID 23672700
sodium 3-[(4aR,6R,7R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-phenyl-2-phenylsulfanyl-5H-imidazo[1,2-a]purin-9-one (PubChem CID 23672700) has the molecular formula C24H19N5NaO7PS and a molecular weight of 575.48 g/mol. Its IUPAC name is sodium 3-[(4aR,6R,7R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-phenyl-2-phenylsulfanyl-5H-imidazo[1,2-a]purin-9-one.
| Compound Name | sodium 3-[(4aR,6R,7R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-phenyl-2-phenylsulfanyl-5H-imidazo[1,2-a]purin-9-one |
|---|---|
| PubChem CID | 23672700 |
| Molecular Formula | C24H19N5NaO7PS |
| Molecular Weight | 575.48 g/mol |
| Exact Mass | 575.06 |
| IUPAC Name | sodium 3-[(4aR,6R,7R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-phenyl-2-phenylsulfanyl-5H-imidazo[1,2-a]purin-9-one |
| SMILES | O=c1c2nc(Sc3ccccc3)n([C@@H]3O[C@@H]4COP(=O)([O-])O[C@H]4[C@H]3O)c2nc2[nH]c(-c3ccccc3)cn12.[Na+] |
| InChI | InChI=1S/C24H20N5O7PS.Na/c30-18-19-16(12-34-37(32,33)36-19)35-22(18)29-20-17(26-24(29)38-14-9-5-2-6-10-14)21(31)28-11-15(25-23(28)27-20)13-7-3-1-4-8-13;/h1-11,16,18-19,22,30H,12H2,(H,25,27)(H,32,33);/q;+1/p-1/t16-,18-,19-,22-;/m1./s1 |
| InChIKey | RIZOLXVHIBZZRA-PTDFHQROSA-M |
| XLogP | -0.66 |
| TPSA | 156.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.48 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|