C18H16BrN6O7P — CID 158428488
3-[(6R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-(4-aminophenyl)-2-bromo-5H-imidazo[1,2-a]purin-9-one;hydron (PubChem CID 158428488) has the molecular formula C18H16BrN6O7P and a molecular weight of 539.24 g/mol. Its IUPAC name is 3-[(6R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-(4-aminophenyl)-2-bromo-5H-imidazo[1,2-a]purin-9-one;hydron.
| Compound Name | 3-[(6R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-(4-aminophenyl)-2-bromo-5H-imidazo[1,2-a]purin-9-one;hydron |
|---|---|
| PubChem CID | 158428488 |
| Molecular Formula | C18H16BrN6O7P |
| Molecular Weight | 539.24 g/mol |
| Exact Mass | 538.00 |
| IUPAC Name | 3-[(6R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-(4-aminophenyl)-2-bromo-5H-imidazo[1,2-a]purin-9-one;hydron |
| SMILES | Nc1ccc(-c2cn3c(=O)c4nc(Br)n([C@@H]5OC6COP(=O)([O-])O[C@H]6C5O)c4nc3[nH]2)cc1.[H+] |
| InChI | InChI=1S/C18H16BrN6O7P/c19-17-22-11-14(25(17)16-12(26)13-10(31-16)6-30-33(28,29)32-13)23-18-21-9(5-24(18)15(11)27)7-1-3-8(20)4-2-7/h1-5,10,12-13,16,26H,6,20H2,(H,21,23)(H,28,29)/t10?,12?,13-,16-/m1/s1 |
| InChIKey | CHHSDAZELQMUKA-OSIYLENDSA-N |
| XLogP | 0.64 |
| TPSA | 182.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|