C24H26N5O7PS — CID 158974507
3-[(6R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-cyclohexylsulfanyl-6-phenyl-5H-imidazo[1,2-a]purin-9-one;hydron (PubChem CID 158974507) has the molecular formula C24H26N5O7PS and a molecular weight of 559.54 g/mol. Its IUPAC name is 3-[(6R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-cyclohexylsulfanyl-6-phenyl-5H-imidazo[1,2-a]purin-9-one;hydron.
| Compound Name | 3-[(6R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-cyclohexylsulfanyl-6-phenyl-5H-imidazo[1,2-a]purin-9-one;hydron |
|---|---|
| PubChem CID | 158974507 |
| Molecular Formula | C24H26N5O7PS |
| Molecular Weight | 559.54 g/mol |
| Exact Mass | 559.13 |
| IUPAC Name | 3-[(6R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-cyclohexylsulfanyl-6-phenyl-5H-imidazo[1,2-a]purin-9-one;hydron |
| SMILES | O=c1c2nc(SC3CCCCC3)n([C@@H]3OC4COP(=O)([O-])O[C@H]4C3O)c2nc2[nH]c(-c3ccccc3)cn12.[H+] |
| InChI | InChI=1S/C24H26N5O7PS/c30-18-19-16(12-34-37(32,33)36-19)35-22(18)29-20-17(26-24(29)38-14-9-5-2-6-10-14)21(31)28-11-15(25-23(28)27-20)13-7-3-1-4-8-13/h1,3-4,7-8,11,14,16,18-19,22,30H,2,5-6,9-10,12H2,(H,25,27)(H,32,33)/t16?,18?,19-,22-/m1/s1 |
| InChIKey | HNXKQAFDQCETLD-FLWHBHCVSA-N |
| XLogP | 2.72 |
| TPSA | 156.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.54 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|