C24H21N5O7PS2+ — CID 176554823
3-[(6R)-2,7-dihydroxy-2-sulfanyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-2-(4-hydroxyphenyl)sulfanyl-6-phenyl-5H-imidazo[1,2-a]purin-9-one (PubChem CID 176554823) has the molecular formula C24H21N5O7PS2+ and a molecular weight of 586.57 g/mol. Its IUPAC name is 3-[(6R)-2,7-dihydroxy-2-sulfanyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-2-(4-hydroxyphenyl)sulfanyl-6-phenyl-5H-imidazo[1,2-a]purin-9-one.
| Compound Name | 3-[(6R)-2,7-dihydroxy-2-sulfanyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-2-(4-hydroxyphenyl)sulfanyl-6-phenyl-5H-imidazo[1,2-a]purin-9-one |
|---|---|
| PubChem CID | 176554823 |
| Molecular Formula | C24H21N5O7PS2+ |
| Molecular Weight | 586.57 g/mol |
| Exact Mass | 586.06 |
| IUPAC Name | 3-[(6R)-2,7-dihydroxy-2-sulfanyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-2-(4-hydroxyphenyl)sulfanyl-6-phenyl-5H-imidazo[1,2-a]purin-9-one |
| SMILES | O=c1c2nc(Sc3ccc(O)cc3)n([C@@H]3OC4CO[P+](O)(S)OC4C3O)c2nc2[nH]c(-c3ccccc3)cn12 |
| InChI | InChI=1S/C24H20N5O7PS2/c30-13-6-8-14(9-7-13)39-24-26-17-20(29(24)22-18(31)19-16(35-22)11-34-37(33,38)36-19)27-23-25-15(10-28(23)21(17)32)12-4-2-1-3-5-12/h1-10,16,18-19,22,31,33,38H,11H2,(H-,25,27,30,32)/p+1/t16?,18?,19?,22-,37?/m1/s1 |
| InChIKey | XZVSDOPDWGEFDR-JEOSXZJISA-O |
| XLogP | 3.17 |
| TPSA | 156.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.57 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|