C16H22N5O9PS — CID 159328877
methyl 5-[[9-[(6R,7aS)-2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-6-oxo-1H-purin-8-yl]sulfanyl]pentanoate (PubChem CID 159328877) has the molecular formula C16H22N5O9PS and a molecular weight of 491.42 g/mol. Its IUPAC name is methyl 5-[[9-[(6R,7aS)-2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-6-oxo-1H-purin-8-yl]sulfanyl]pentanoate.
| Compound Name | methyl 5-[[9-[(6R,7aS)-2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-6-oxo-1H-purin-8-yl]sulfanyl]pentanoate |
|---|---|
| PubChem CID | 159328877 |
| Molecular Formula | C16H22N5O9PS |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | methyl 5-[[9-[(6R,7aS)-2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-6-oxo-1H-purin-8-yl]sulfanyl]pentanoate |
| SMILES | COC(=O)CCCCSc1nc2c(=O)[nH]c(N)nc2n1[C@@H]1OC2COP(=O)(O)O[C@H]2C1O |
| InChI | InChI=1S/C16H22N5O9PS/c1-27-8(22)4-2-3-5-32-16-18-9-12(19-15(17)20-13(9)24)21(16)14-10(23)11-7(29-14)6-28-31(25,26)30-11/h7,10-11,14,23H,2-6H2,1H3,(H,25,26)(H3,17,19,20,24)/t7?,10?,11-,14-/m1/s1 |
| InChIKey | HBQXTSFTVCNHLW-OMNZJCLQSA-N |
| XLogP | -0.09 |
| TPSA | 201.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|