C13H16N5O7PS — CID 170065535
methyl 2-[[2-amino-9-(7-hydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)-6-oxo-1H-purin-8-yl]sulfanyl]acetate (PubChem CID 170065535) has the molecular formula C13H16N5O7PS and a molecular weight of 417.34 g/mol. Its IUPAC name is methyl 2-[[2-amino-9-(7-hydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)-6-oxo-1H-purin-8-yl]sulfanyl]acetate.
| Compound Name | methyl 2-[[2-amino-9-(7-hydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)-6-oxo-1H-purin-8-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 170065535 |
| Molecular Formula | C13H16N5O7PS |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | methyl 2-[[2-amino-9-(7-hydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)-6-oxo-1H-purin-8-yl]sulfanyl]acetate |
| SMILES | COC(=O)CSc1nc2c(=O)[nH]c(N)nc2n1C1OC2COPOC2C1O |
| InChI | InChI=1S/C13H16N5O7PS/c1-22-5(19)3-27-13-15-6-9(16-12(14)17-10(6)21)18(13)11-7(20)8-4(24-11)2-23-26-25-8/h4,7-8,11,20,26H,2-3H2,1H3,(H3,14,16,17,21) |
| InChIKey | KOFZMRCACARRSE-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 163.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|